C11H19ClN2OS — CID 120651296
N-[(2R)-2-(ethylamino)propyl]-4-methylthiophene-3-carboxamide;hydrochloride (PubChem CID 120651296) has the molecular formula C11H19ClN2OS and a molecular weight of 262.81 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-4-methylthiophene-3-carboxamide;hydrochloride.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-4-methylthiophene-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120651296 |
| Molecular Formula | C11H19ClN2OS |
| Molecular Weight | 262.81 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-4-methylthiophene-3-carboxamide;hydrochloride |
| SMILES | CCN[C@H](C)CNC(=O)c1cscc1C.Cl |
| InChI | InChI=1S/C11H18N2OS.ClH/c1-4-12-9(3)5-13-11(14)10-7-15-6-8(10)2;/h6-7,9,12H,4-5H2,1-3H3,(H,13,14);1H/t9-;/m1./s1 |
| InChIKey | YAEXGUBAMOLJKW-SBSPUUFOSA-N |
| XLogP | 2.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.81 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |