C13H17BrFNO — CID 114316527
N-(5-bromopentan-2-yl)-2-(2-fluorophenyl)acetamide (PubChem CID 114316527) has the molecular formula C13H17BrFNO and a molecular weight of 302.19 g/mol. Its IUPAC name is N-(5-bromopentan-2-yl)-2-(2-fluorophenyl)acetamide.
| Compound Name | N-(5-bromopentan-2-yl)-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 114316527 |
| Molecular Formula | C13H17BrFNO |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N-(5-bromopentan-2-yl)-2-(2-fluorophenyl)acetamide |
| SMILES | CC(CCCBr)NC(=O)Cc1ccccc1F |
| InChI | InChI=1S/C13H17BrFNO/c1-10(5-4-8-14)16-13(17)9-11-6-2-3-7-12(11)15/h2-3,6-7,10H,4-5,8-9H2,1H3,(H,16,17) |
| InChIKey | IJTASVNZKJHELS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|