C15H18BrN3O — CID 114317417
N-[[2-(bromomethyl)cyclohexyl]methyl]-5-cyanopyridine-2-carboxamide (PubChem CID 114317417) has the molecular formula C15H18BrN3O and a molecular weight of 336.23 g/mol. Its IUPAC name is N-[[2-(bromomethyl)cyclohexyl]methyl]-5-cyanopyridine-2-carboxamide.
| Compound Name | N-[[2-(bromomethyl)cyclohexyl]methyl]-5-cyanopyridine-2-carboxamide |
|---|---|
| PubChem CID | 114317417 |
| Molecular Formula | C15H18BrN3O |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-[[2-(bromomethyl)cyclohexyl]methyl]-5-cyanopyridine-2-carboxamide |
| SMILES | N#Cc1ccc(C(=O)NCC2CCCCC2CBr)nc1 |
| InChI | InChI=1S/C15H18BrN3O/c16-7-12-3-1-2-4-13(12)10-19-15(20)14-6-5-11(8-17)9-18-14/h5-6,9,12-13H,1-4,7,10H2,(H,19,20) |
| InChIKey | LJNCWXSTDDWOPL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|