C16H24ClNO3 — CID 114319500
methyl 3-[3-chloro-2-(propylaminomethyl)phenoxy]-2,2-dimethylpropanoate (PubChem CID 114319500) has the molecular formula C16H24ClNO3 and a molecular weight of 313.83 g/mol. Its IUPAC name is methyl 3-[3-chloro-2-(propylaminomethyl)phenoxy]-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[3-chloro-2-(propylaminomethyl)phenoxy]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 114319500 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | methyl 3-[3-chloro-2-(propylaminomethyl)phenoxy]-2,2-dimethylpropanoate |
| SMILES | CCCNCc1c(Cl)cccc1OCC(C)(C)C(=O)OC |
| InChI | InChI=1S/C16H24ClNO3/c1-5-9-18-10-12-13(17)7-6-8-14(12)21-11-16(2,3)15(19)20-4/h6-8,18H,5,9-11H2,1-4H3 |
| InChIKey | DAHBCUAFSFLVOB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|