C13H10F3N3O2 — CID 114324570
2-[[[3-(trifluoromethyl)-2-pyridinyl]amino]methyl]pyridine-4-carboxylic acid (PubChem CID 114324570) has the molecular formula C13H10F3N3O2 and a molecular weight of 297.24 g/mol. Its IUPAC name is 2-[[[3-(trifluoromethyl)-2-pyridinyl]amino]methyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[[[3-(trifluoromethyl)-2-pyridinyl]amino]methyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114324570 |
| Molecular Formula | C13H10F3N3O2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-[[[3-(trifluoromethyl)-2-pyridinyl]amino]methyl]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(CNc2ncccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C13H10F3N3O2/c14-13(15,16)10-2-1-4-18-11(10)19-7-9-6-8(12(20)21)3-5-17-9/h1-6H,7H2,(H,18,19)(H,20,21) |
| InChIKey | HHZLWHPCRHBASH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |