C11H9F3N2O — CID 115620858
N-(furan-3-ylmethyl)-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 115620858) has the molecular formula C11H9F3N2O and a molecular weight of 242.20 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(furan-3-ylmethyl)-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 115620858 |
| Molecular Formula | C11H9F3N2O |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | N-(furan-3-ylmethyl)-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cccnc1NCc1ccoc1 |
| InChI | InChI=1S/C11H9F3N2O/c12-11(13,14)9-2-1-4-15-10(9)16-6-8-3-5-17-7-8/h1-5,7H,6H2,(H,15,16) |
| InChIKey | SHCSJAMKZFXITF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |