C16H12F4N4 — CID 47983158
N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 47983158) has the molecular formula C16H12F4N4 and a molecular weight of 336.29 g/mol. Its IUPAC name is N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 47983158 |
| Molecular Formula | C16H12F4N4 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | Fc1cc(CNc2ncccc2C(F)(F)F)ccc1-n1ccnc1 |
| InChI | InChI=1S/C16H12F4N4/c17-13-8-11(3-4-14(13)24-7-6-21-10-24)9-23-15-12(16(18,19)20)2-1-5-22-15/h1-8,10H,9H2,(H,22,23) |
| InChIKey | FXQMENBDICEVEI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |