C18H14F3N3 — CID 133332763
N-[(4-pyridin-3-ylphenyl)methyl]-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 133332763) has the molecular formula C18H14F3N3 and a molecular weight of 329.33 g/mol. Its IUPAC name is N-[(4-pyridin-3-ylphenyl)methyl]-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(4-pyridin-3-ylphenyl)methyl]-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 133332763 |
| Molecular Formula | C18H14F3N3 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | N-[(4-pyridin-3-ylphenyl)methyl]-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cccnc1NCc1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C18H14F3N3/c19-18(20,21)16-4-2-10-23-17(16)24-11-13-5-7-14(8-6-13)15-3-1-9-22-12-15/h1-10,12H,11H2,(H,23,24) |
| InChIKey | CHSMCBGQZNHHSJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |