C14H15N3O3S — CID 114325907
2-(aminomethyl)-N-(3-methylsulfonylphenyl)pyridine-4-carboxamide (PubChem CID 114325907) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(3-methylsulfonylphenyl)pyridine-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-(3-methylsulfonylphenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114325907 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-(aminomethyl)-N-(3-methylsulfonylphenyl)pyridine-4-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)c2ccnc(CN)c2)c1 |
| InChI | InChI=1S/C14H15N3O3S/c1-21(19,20)13-4-2-3-11(8-13)17-14(18)10-5-6-16-12(7-10)9-15/h2-8H,9,15H2,1H3,(H,17,18) |
| InChIKey | NJWIIZMSBRNPFA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |