C14H14N4O2 — CID 114325508
2-(aminomethyl)-N-(4-carbamoylphenyl)pyridine-4-carboxamide (PubChem CID 114325508) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(4-carbamoylphenyl)pyridine-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-(4-carbamoylphenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114325508 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-(aminomethyl)-N-(4-carbamoylphenyl)pyridine-4-carboxamide |
| SMILES | NCc1cc(C(=O)Nc2ccc(C(N)=O)cc2)ccn1 |
| InChI | InChI=1S/C14H14N4O2/c15-8-12-7-10(5-6-17-12)14(20)18-11-3-1-9(2-4-11)13(16)19/h1-7H,8,15H2,(H2,16,19)(H,18,20) |
| InChIKey | HUQQJUCAYRYKTR-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |