C8H8N6OS — CID 114912577
2-(aminomethyl)-N-(thiatriazol-5-yl)pyridine-4-carboxamide (PubChem CID 114912577) has the molecular formula C8H8N6OS and a molecular weight of 236.26 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(thiatriazol-5-yl)pyridine-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-(thiatriazol-5-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114912577 |
| Molecular Formula | C8H8N6OS |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 2-(aminomethyl)-N-(thiatriazol-5-yl)pyridine-4-carboxamide |
| SMILES | NCc1cc(C(=O)Nc2nnns2)ccn1 |
| InChI | InChI=1S/C8H8N6OS/c9-4-6-3-5(1-2-10-6)7(15)11-8-12-13-14-16-8/h1-3H,4,9H2,(H,11,12,14,15) |
| InChIKey | IYUYURDAQMKAEP-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |