C14H12ClN3O3 — CID 114326185
2-[[2-(aminomethyl)pyridine-4-carbonyl]amino]-4-chlorobenzoic acid (PubChem CID 114326185) has the molecular formula C14H12ClN3O3 and a molecular weight of 305.72 g/mol. Its IUPAC name is 2-[[2-(aminomethyl)pyridine-4-carbonyl]amino]-4-chlorobenzoic acid.
| Compound Name | 2-[[2-(aminomethyl)pyridine-4-carbonyl]amino]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 114326185 |
| Molecular Formula | C14H12ClN3O3 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-[[2-(aminomethyl)pyridine-4-carbonyl]amino]-4-chlorobenzoic acid |
| SMILES | NCc1cc(C(=O)Nc2cc(Cl)ccc2C(=O)O)ccn1 |
| InChI | InChI=1S/C14H12ClN3O3/c15-9-1-2-11(14(20)21)12(6-9)18-13(19)8-3-4-17-10(5-8)7-16/h1-6H,7,16H2,(H,18,19)(H,20,21) |
| InChIKey | IJHCAQANCCVHHZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |