C12H20BrNO — CID 114328811
1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-bromo-2-methylpropan-1-one (PubChem CID 114328811) has the molecular formula C12H20BrNO and a molecular weight of 274.20 g/mol. Its IUPAC name is 1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-bromo-2-methylpropan-1-one.
| Compound Name | 1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-bromo-2-methylpropan-1-one |
|---|---|
| PubChem CID | 114328811 |
| Molecular Formula | C12H20BrNO |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-bromo-2-methylpropan-1-one |
| SMILES | CC(C)(Br)C(=O)N1CCCC2CCCC21 |
| InChI | InChI=1S/C12H20BrNO/c1-12(2,13)11(15)14-8-4-6-9-5-3-7-10(9)14/h9-10H,3-8H2,1-2H3 |
| InChIKey | MKKZLXVHLMJCPN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|