C15H19F3N2O — CID 97349266
[(4aR,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl]-[1-methyl-4-(trifluoromethyl)pyrrol-3-yl]methanone (PubChem CID 97349266) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is [(4aR,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl]-[1-methyl-4-(trifluoromethyl)pyrrol-3-yl]methanone.
| Compound Name | [(4aR,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl]-[1-methyl-4-(trifluoromethyl)pyrrol-3-yl]methanone |
|---|---|
| PubChem CID | 97349266 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | [(4aR,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl]-[1-methyl-4-(trifluoromethyl)pyrrol-3-yl]methanone |
| SMILES | Cn1cc(C(=O)N2CCC[C@H]3CCC[C@@H]32)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H19F3N2O/c1-19-8-11(12(9-19)15(16,17)18)14(21)20-7-3-5-10-4-2-6-13(10)20/h8-10,13H,2-7H2,1H3/t10-,13+/m1/s1 |
| InChIKey | DMICFMROWQJBNF-MFKMUULPSA-N |
| XLogP | 3.45 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |