C15H19BrO — CID 114329532
(4-bromo-3,5-dimethylphenyl)-cyclohexylmethanone (PubChem CID 114329532) has the molecular formula C15H19BrO and a molecular weight of 295.22 g/mol. Its IUPAC name is (4-bromo-3,5-dimethylphenyl)-cyclohexylmethanone.
| Compound Name | (4-bromo-3,5-dimethylphenyl)-cyclohexylmethanone |
|---|---|
| PubChem CID | 114329532 |
| Molecular Formula | C15H19BrO |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | (4-bromo-3,5-dimethylphenyl)-cyclohexylmethanone |
| SMILES | Cc1cc(C(=O)C2CCCCC2)cc(C)c1Br |
| InChI | InChI=1S/C15H19BrO/c1-10-8-13(9-11(2)14(10)16)15(17)12-6-4-3-5-7-12/h8-9,12H,3-7H2,1-2H3 |
| InChIKey | RHODEQOQVZBOGK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |