C14H17FO — CID 65298882
cyclopentyl-(4-fluoro-3,5-dimethylphenyl)methanone (PubChem CID 65298882) has the molecular formula C14H17FO and a molecular weight of 220.29 g/mol. Its IUPAC name is cyclopentyl-(4-fluoro-3,5-dimethylphenyl)methanone.
| Compound Name | cyclopentyl-(4-fluoro-3,5-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 65298882 |
| Molecular Formula | C14H17FO |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | cyclopentyl-(4-fluoro-3,5-dimethylphenyl)methanone |
| SMILES | Cc1cc(C(=O)C2CCCC2)cc(C)c1F |
| InChI | InChI=1S/C14H17FO/c1-9-7-12(8-10(2)13(9)15)14(16)11-5-3-4-6-11/h7-8,11H,3-6H2,1-2H3 |
| InChIKey | IYJUYZVHMVBNTL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |