C27H30F6N2O3S — CID 11433132
8-[3-[bis[3-(trifluoromethyl)phenyl]methoxy]propyl]-3-(methylsulfanylmethyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one (PubChem CID 11433132) has the molecular formula C27H30F6N2O3S and a molecular weight of 576.60 g/mol. Its IUPAC name is 8-[3-[bis[3-(trifluoromethyl)phenyl]methoxy]propyl]-3-(methylsulfanylmethyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-[3-[bis[3-(trifluoromethyl)phenyl]methoxy]propyl]-3-(methylsulfanylmethyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 11433132 |
| Molecular Formula | C27H30F6N2O3S |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.19 |
| IUPAC Name | 8-[3-[bis[3-(trifluoromethyl)phenyl]methoxy]propyl]-3-(methylsulfanylmethyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
| SMILES | CSCN1CC2(CCN(CCCOC(c3cccc(C(F)(F)F)c3)c3cccc(C(F)(F)F)c3)CC2)OC1=O |
| InChI | InChI=1S/C27H30F6N2O3S/c1-39-18-35-17-25(38-24(35)36)9-12-34(13-10-25)11-4-14-37-23(19-5-2-7-21(15-19)26(28,29)30)20-6-3-8-22(16-20)27(31,32)33/h2-3,5-8,15-16,23H,4,9-14,17-18H2,1H3 |
| InChIKey | KZSYLFMDISVCEA-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|