C18H32N2 — CID 114333063
2-methyl-2-N-(4-phenylbutyl)-2-N-propylbutane-1,2-diamine (PubChem CID 114333063) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is 2-methyl-2-N-(4-phenylbutyl)-2-N-propylbutane-1,2-diamine.
| Compound Name | 2-methyl-2-N-(4-phenylbutyl)-2-N-propylbutane-1,2-diamine |
|---|---|
| PubChem CID | 114333063 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | 2-methyl-2-N-(4-phenylbutyl)-2-N-propylbutane-1,2-diamine |
| SMILES | CCCN(CCCCc1ccccc1)C(C)(CC)CN |
| InChI | InChI=1S/C18H32N2/c1-4-14-20(18(3,5-2)16-19)15-10-9-13-17-11-7-6-8-12-17/h6-8,11-12H,4-5,9-10,13-16,19H2,1-3H3 |
| InChIKey | PTWVWMMDVJSAPN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|