C18H31FN2 — CID 114831034
2-N,2-N-dibutyl-3-(3-fluorophenyl)-2-methylpropane-1,2-diamine (PubChem CID 114831034) has the molecular formula C18H31FN2 and a molecular weight of 294.46 g/mol. Its IUPAC name is 2-N,2-N-dibutyl-3-(3-fluorophenyl)-2-methylpropane-1,2-diamine.
| Compound Name | 2-N,2-N-dibutyl-3-(3-fluorophenyl)-2-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 114831034 |
| Molecular Formula | C18H31FN2 |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | 2-N,2-N-dibutyl-3-(3-fluorophenyl)-2-methylpropane-1,2-diamine |
| SMILES | CCCCN(CCCC)C(C)(CN)Cc1cccc(F)c1 |
| InChI | InChI=1S/C18H31FN2/c1-4-6-11-21(12-7-5-2)18(3,15-20)14-16-9-8-10-17(19)13-16/h8-10,13H,4-7,11-12,14-15,20H2,1-3H3 |
| InChIKey | QOYRBCGZLQGAEY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |