C34H41FN2O8 — CID 11433569
[3-(nitrooxymethyl)phenyl]methyl (E,3R,5S)-7-[4-(4-fluorophenyl)-5-(methoxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]-3,5-dihydroxyhept-6-enoate (PubChem CID 11433569) has the molecular formula C34H41FN2O8 and a molecular weight of 624.71 g/mol. Its IUPAC name is [3-(nitrooxymethyl)phenyl]methyl (E,3R,5S)-7-[4-(4-fluorophenyl)-5-(methoxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]-3,5-dihydroxyhept-6-enoate.
| Compound Name | [3-(nitrooxymethyl)phenyl]methyl (E,3R,5S)-7-[4-(4-fluorophenyl)-5-(methoxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]-3,5-dihydroxyhept-6-enoate |
|---|---|
| PubChem CID | 11433569 |
| Molecular Formula | C34H41FN2O8 |
| Molecular Weight | 624.71 g/mol |
| Exact Mass | 624.28 |
| IUPAC Name | [3-(nitrooxymethyl)phenyl]methyl (E,3R,5S)-7-[4-(4-fluorophenyl)-5-(methoxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]-3,5-dihydroxyhept-6-enoate |
| SMILES | COCc1c(C(C)C)nc(C(C)C)c(/C=C/[C@@H](O)C[C@@H](O)CC(=O)OCc2cccc(CO[N+](=O)[O-])c2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C34H41FN2O8/c1-21(2)33-29(32(25-9-11-26(35)12-10-25)30(20-43-5)34(36-33)22(3)4)14-13-27(38)16-28(39)17-31(40)44-18-23-7-6-8-24(15-23)19-45-37(41)42/h6-15,21-22,27-28,38-39H,16-20H2,1-5H3/b14-13+/t27-,28-/m1/s1 |
| InChIKey | ZLQKUEAXMIYXDH-QENFQLAYSA-N |
| XLogP | 6.25 |
| TPSA | 141.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.71 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|