C26H35FN2O5 — CID 149125152
(E,3R)-7-[4-(4-fluorophenyl)-5-(methoxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]-N,3,5-trihydroxyhept-6-enamide (PubChem CID 149125152) has the molecular formula C26H35FN2O5 and a molecular weight of 474.57 g/mol. Its IUPAC name is (E,3R)-7-[4-(4-fluorophenyl)-5-(methoxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]-N,3,5-trihydroxyhept-6-enamide.
| Compound Name | (E,3R)-7-[4-(4-fluorophenyl)-5-(methoxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]-N,3,5-trihydroxyhept-6-enamide |
|---|---|
| PubChem CID | 149125152 |
| Molecular Formula | C26H35FN2O5 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | (E,3R)-7-[4-(4-fluorophenyl)-5-(methoxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]-N,3,5-trihydroxyhept-6-enamide |
| SMILES | COCc1c(C(C)C)nc(C(C)C)c(/C=C/C(O)C[C@@H](O)CC(=O)NO)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H35FN2O5/c1-15(2)25-21(11-10-19(30)12-20(31)13-23(32)29-33)24(17-6-8-18(27)9-7-17)22(14-34-5)26(28-25)16(3)4/h6-11,15-16,19-20,30-31,33H,12-14H2,1-5H3,(H,29,32)/b11-10+/t19?,20-/m1/s1 |
| InChIKey | RATJSJRYBKIYAO-FQUJLXTPSA-N |
| XLogP | 4.30 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|