C18H28N2O — CID 114337326
(NZ)-N-[1-(2-ethylhexyl)-3,4-dihydro-2H-1-benzazepin-5-ylidene]hydroxylamine (PubChem CID 114337326) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is (NZ)-N-[1-(2-ethylhexyl)-3,4-dihydro-2H-1-benzazepin-5-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-(2-ethylhexyl)-3,4-dihydro-2H-1-benzazepin-5-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 114337326 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | (NZ)-N-[1-(2-ethylhexyl)-3,4-dihydro-2H-1-benzazepin-5-ylidene]hydroxylamine |
| SMILES | CCCCC(CC)CN1CCC/C(=N/O)c2ccccc21 |
| InChI | InChI=1S/C18H28N2O/c1-3-5-9-15(4-2)14-20-13-8-11-17(19-21)16-10-6-7-12-18(16)20/h6-7,10,12,15,21H,3-5,8-9,11,13-14H2,1-2H3/b19-17- |
| InChIKey | SGIUJAWTWNLWMT-ZPHPHTNESA-N |
| XLogP | 4.68 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|