C16H15N5O4S — CID 1143383
N'-acetyl-2-[(7-methyl-12,14-dioxa-2,4,5-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),3,5,7,9,11(15)-hexaen-3-yl)sulfanyl]acetohydrazide (PubChem CID 1143383) has the molecular formula C16H15N5O4S and a molecular weight of 373.39 g/mol. Its IUPAC name is N'-acetyl-2-[(7-methyl-12,14-dioxa-2,4,5-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),3,5,7,9,11(15)-hexaen-3-yl)sulfanyl]acetohydrazide.
| Compound Name | N'-acetyl-2-[(7-methyl-12,14-dioxa-2,4,5-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),3,5,7,9,11(15)-hexaen-3-yl)sulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 1143383 |
| Molecular Formula | C16H15N5O4S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | N'-acetyl-2-[(7-methyl-12,14-dioxa-2,4,5-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),3,5,7,9,11(15)-hexaen-3-yl)sulfanyl]acetohydrazide |
| SMILES | CC(=O)NNC(=O)CSc1nnc2c(C)cc3cc4c(cc3n12)OCO4 |
| InChI | InChI=1S/C16H15N5O4S/c1-8-3-10-4-12-13(25-7-24-12)5-11(10)21-15(8)19-20-16(21)26-6-14(23)18-17-9(2)22/h3-5H,6-7H2,1-2H3,(H,17,22)(H,18,23) |
| InChIKey | SZGZDKHSVFUDEH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|