C11H14N6O2S — CID 7940292
N'-acetyl-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetohydrazide (PubChem CID 7940292) has the molecular formula C11H14N6O2S and a molecular weight of 294.34 g/mol. Its IUPAC name is N'-acetyl-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetohydrazide.
| Compound Name | N'-acetyl-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 7940292 |
| Molecular Formula | C11H14N6O2S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | N'-acetyl-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetohydrazide |
| SMILES | CC(=O)NNC(=O)CSc1nnc2nc(C)cc(C)n12 |
| InChI | InChI=1S/C11H14N6O2S/c1-6-4-7(2)17-10(12-6)15-16-11(17)20-5-9(19)14-13-8(3)18/h4H,5H2,1-3H3,(H,13,18)(H,14,19) |
| InChIKey | VLTMNLGVLJRFNK-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|