C12H13N7OS2 — CID 43816403
2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 43816403) has the molecular formula C12H13N7OS2 and a molecular weight of 335.42 g/mol. Its IUPAC name is 2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 43816403 |
| Molecular Formula | C12H13N7OS2 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | Cc1cc(C)n2c(SCC(=O)Nc3nnc(C)s3)nnc2n1 |
| InChI | InChI=1S/C12H13N7OS2/c1-6-4-7(2)19-10(13-6)16-18-12(19)21-5-9(20)14-11-17-15-8(3)22-11/h4H,5H2,1-3H3,(H,14,17,20) |
| InChIKey | RBYFYDKNBSSDNE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |