C17H25N5OS — CID 2361363
N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetamide (PubChem CID 2361363) has the molecular formula C17H25N5OS and a molecular weight of 347.49 g/mol. Its IUPAC name is N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetamide.
| Compound Name | N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 2361363 |
| Molecular Formula | C17H25N5OS |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetamide |
| SMILES | Cc1cc(C)n2c(SCC(=O)N[C@H]3CCC[C@@H](C)[C@H]3C)nnc2n1 |
| InChI | InChI=1S/C17H25N5OS/c1-10-6-5-7-14(13(10)4)19-15(23)9-24-17-21-20-16-18-11(2)8-12(3)22(16)17/h8,10,13-14H,5-7,9H2,1-4H3,(H,19,23)/t10-,13-,14+/m1/s1 |
| InChIKey | YOYTWHWCTHFBMC-HONMWMINSA-N |
| XLogP | 2.77 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |