C20H31NOS — CID 11906066
N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(2,3,5,6-tetramethylphenyl)sulfanylacetamide (PubChem CID 11906066) has the molecular formula C20H31NOS and a molecular weight of 333.54 g/mol. Its IUPAC name is N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(2,3,5,6-tetramethylphenyl)sulfanylacetamide.
| Compound Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(2,3,5,6-tetramethylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 11906066 |
| Molecular Formula | C20H31NOS |
| Molecular Weight | 333.54 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(2,3,5,6-tetramethylphenyl)sulfanylacetamide |
| SMILES | Cc1cc(C)c(C)c(SCC(=O)N[C@@H]2CCC[C@@H](C)[C@@H]2C)c1C |
| InChI | InChI=1S/C20H31NOS/c1-12-8-7-9-18(15(12)4)21-19(22)11-23-20-16(5)13(2)10-14(3)17(20)6/h10,12,15,18H,7-9,11H2,1-6H3,(H,21,22)/t12-,15+,18-/m1/s1 |
| InChIKey | KBTWNLZQJWAKBB-HNJNHCNJSA-N |
| XLogP | 4.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |