C13H22N6OS — CID 11916666
2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]acetamide (PubChem CID 11916666) has the molecular formula C13H22N6OS and a molecular weight of 310.43 g/mol. Its IUPAC name is 2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]acetamide.
| Compound Name | 2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 11916666 |
| Molecular Formula | C13H22N6OS |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]acetamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CSc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C13H22N6OS/c1-7-4-3-5-9(8(7)2)16-10(20)6-21-13-18-11(14)17-12(15)19-13/h7-9H,3-6H2,1-2H3,(H,16,20)(H4,14,15,17,18,19)/t7-,8-,9+/m1/s1 |
| InChIKey | QDRUGSFSAWFUGR-HLTSFMKQSA-N |
| XLogP | 1.07 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |