C12H22ClNO — CID 114338861
1-[1-[(E)-3-chloroprop-2-enyl]azepan-2-yl]propan-2-ol (PubChem CID 114338861) has the molecular formula C12H22ClNO and a molecular weight of 231.77 g/mol. Its IUPAC name is 1-[1-[(E)-3-chloroprop-2-enyl]azepan-2-yl]propan-2-ol.
| Compound Name | 1-[1-[(E)-3-chloroprop-2-enyl]azepan-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 114338861 |
| Molecular Formula | C12H22ClNO |
| Molecular Weight | 231.77 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 1-[1-[(E)-3-chloroprop-2-enyl]azepan-2-yl]propan-2-ol |
| SMILES | CC(O)CC1CCCCCN1C/C=C/Cl |
| InChI | InChI=1S/C12H22ClNO/c1-11(15)10-12-6-3-2-4-8-14(12)9-5-7-13/h5,7,11-12,15H,2-4,6,8-10H2,1H3/b7-5+ |
| InChIKey | SFSLWBZMSQRGOB-FNORWQNLSA-N |
| XLogP | 2.75 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.77 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |