C12H21Cl2NO — CID 104893915
1-[1-(2,3-dichloroprop-2-enyl)azepan-2-yl]propan-2-ol (PubChem CID 104893915) has the molecular formula C12H21Cl2NO and a molecular weight of 266.21 g/mol. Its IUPAC name is 1-[1-(2,3-dichloroprop-2-enyl)azepan-2-yl]propan-2-ol.
| Compound Name | 1-[1-(2,3-dichloroprop-2-enyl)azepan-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 104893915 |
| Molecular Formula | C12H21Cl2NO |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 1-[1-(2,3-dichloroprop-2-enyl)azepan-2-yl]propan-2-ol |
| SMILES | CC(O)CC1CCCCCN1CC(Cl)=CCl |
| InChI | InChI=1S/C12H21Cl2NO/c1-10(16)7-12-5-3-2-4-6-15(12)9-11(14)8-13/h8,10,12,16H,2-7,9H2,1H3 |
| InChIKey | PARYHNPFDZLWOY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |