C17H23F2NO — CID 114339484
2-[1-[(2,5-difluorophenyl)methyl]pyrrolidin-2-yl]cyclohexan-1-ol (PubChem CID 114339484) has the molecular formula C17H23F2NO and a molecular weight of 295.37 g/mol. Its IUPAC name is 2-[1-[(2,5-difluorophenyl)methyl]pyrrolidin-2-yl]cyclohexan-1-ol.
| Compound Name | 2-[1-[(2,5-difluorophenyl)methyl]pyrrolidin-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 114339484 |
| Molecular Formula | C17H23F2NO |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 2-[1-[(2,5-difluorophenyl)methyl]pyrrolidin-2-yl]cyclohexan-1-ol |
| SMILES | OC1CCCCC1C1CCCN1Cc1cc(F)ccc1F |
| InChI | InChI=1S/C17H23F2NO/c18-13-7-8-15(19)12(10-13)11-20-9-3-5-16(20)14-4-1-2-6-17(14)21/h7-8,10,14,16-17,21H,1-6,9,11H2 |
| InChIKey | DXLZMAIUJTWHNM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |