About 4-[(4,4-dimethylcyclohexyl)oxymethyl]-1,3-thiazole-2-carboxylic acid
4-[(4,4-dimethylcyclohexyl)oxymethyl]-1,3-thiazole-2-carboxylic acid (PubChem CID 114340364) has the molecular formula C13H19NO3S
and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-[(4,4-dimethylcyclohexyl)oxymethyl]-1,3-thiazole-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(4,4-dimethylcyclohexyl)oxymethyl]-1,3-thiazole-2-carboxylic acid |
| PubChem CID | 114340364 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 4-[(4,4-dimethylcyclohexyl)oxymethyl]-1,3-thiazole-2-carboxylic acid |
| SMILES | CC1(C)CCC(OCc2csc(C(=O)O)n2)CC1 |
| InChI | InChI=1S/C13H19NO3S/c1-13(2)5-3-10(4-6-13)17-7-9-8-18-11(14-9)12(15)16/h8,10H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | FSJMWCMRNPLXCP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(4,4-dimethylcyclohexyl)oxymethyl]-1,3-thiazole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4,4-dimethylcyclohexyl)oxymethyl]-1,3-thiazole-2-carboxylic acid?
The IUPAC name of 4-[(4,4-dimethylcyclohexyl)oxymethyl]-1,3-thiazole-2-carboxylic acid (CID 114340364) is 4-[(4,4-dimethylcyclohexyl)oxymethyl]-1,3-thiazole-2-carboxylic acid.
What is the SMILES notation for 4-[(4,4-dimethylcyclohexyl)oxymethyl]-1,3-thiazole-2-carboxylic acid?
The canonical SMILES for 4-[(4,4-dimethylcyclohexyl)oxymethyl]-1,3-thiazole-2-carboxylic acid is CC1(C)CCC(OCc2csc(C(=O)O)n2)CC1.
What is the InChIKey of 4-[(4,4-dimethylcyclohexyl)oxymethyl]-1,3-thiazole-2-carboxylic acid?
The InChIKey is FSJMWCMRNPLXCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3S/c1-13(2)5-3-10(4-6-13)17-7-9-8-18-11(14-9)12(15)16/h8,10H,3-7H2,1-2H3,(H,15,16).
What are the key properties of 4-[(4,4-dimethylcyclohexyl)oxymethyl]-1,3-thiazole-2-carboxylic acid?
4-[(4,4-dimethylcyclohexyl)oxymethyl]-1,3-thiazole-2-carboxylic acid has a molecular weight of 269.37 g/mol, XLogP of 3.33, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4,4-dimethylcyclohexyl)oxymethyl]-1,3-thiazole-2-carboxylic acid is sourced from PubChem (CID 114340364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).