C8H7NO3S — CID 43664309
4-(prop-2-ynoxymethyl)-1,3-thiazole-2-carboxylic acid (PubChem CID 43664309) has the molecular formula C8H7NO3S and a molecular weight of 197.21 g/mol. Its IUPAC name is 4-(prop-2-ynoxymethyl)-1,3-thiazole-2-carboxylic acid.
| Compound Name | 4-(prop-2-ynoxymethyl)-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 43664309 |
| Molecular Formula | C8H7NO3S |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | 4-(prop-2-ynoxymethyl)-1,3-thiazole-2-carboxylic acid |
| SMILES | C#CCOCc1csc(C(=O)O)n1 |
| InChI | InChI=1S/C8H7NO3S/c1-2-3-12-4-6-5-13-7(9-6)8(10)11/h1,5H,3-4H2,(H,10,11) |
| InChIKey | ZZAIEHWDRYIWHA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|