C8H5F6NO3S — CID 102721454
4-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,3-thiazole-2-carboxylic acid (PubChem CID 102721454) has the molecular formula C8H5F6NO3S and a molecular weight of 309.19 g/mol. Its IUPAC name is 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,3-thiazole-2-carboxylic acid.
| Compound Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 102721454 |
| Molecular Formula | C8H5F6NO3S |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,3-thiazole-2-carboxylic acid |
| SMILES | O=C(O)c1nc(COC(C(F)(F)F)C(F)(F)F)cs1 |
| InChI | InChI=1S/C8H5F6NO3S/c9-7(10,11)6(8(12,13)14)18-1-3-2-19-4(15-3)5(16)17/h2,6H,1H2,(H,16,17) |
| InChIKey | HSZVIYACMRXNPT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |