C14H19BrFNO — CID 114340413
4-bromo-2-(4,4-dimethylcyclohexyl)oxy-5-fluoroaniline (PubChem CID 114340413) has the molecular formula C14H19BrFNO and a molecular weight of 316.21 g/mol. Its IUPAC name is 4-bromo-2-(4,4-dimethylcyclohexyl)oxy-5-fluoroaniline.
| Compound Name | 4-bromo-2-(4,4-dimethylcyclohexyl)oxy-5-fluoroaniline |
|---|---|
| PubChem CID | 114340413 |
| Molecular Formula | C14H19BrFNO |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 4-bromo-2-(4,4-dimethylcyclohexyl)oxy-5-fluoroaniline |
| SMILES | CC1(C)CCC(Oc2cc(Br)c(F)cc2N)CC1 |
| InChI | InChI=1S/C14H19BrFNO/c1-14(2)5-3-9(4-6-14)18-13-7-10(15)11(16)8-12(13)17/h7-9H,3-6,17H2,1-2H3 |
| InChIKey | ZXNAYPVOFBTWHG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|