C15H22FNO2 — CID 114340502
2-(4,4-dimethylcyclohexyl)oxy-5-fluoro-4-methoxyaniline (PubChem CID 114340502) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is 2-(4,4-dimethylcyclohexyl)oxy-5-fluoro-4-methoxyaniline.
| Compound Name | 2-(4,4-dimethylcyclohexyl)oxy-5-fluoro-4-methoxyaniline |
|---|---|
| PubChem CID | 114340502 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-(4,4-dimethylcyclohexyl)oxy-5-fluoro-4-methoxyaniline |
| SMILES | COc1cc(OC2CCC(C)(C)CC2)c(N)cc1F |
| InChI | InChI=1S/C15H22FNO2/c1-15(2)6-4-10(5-7-15)19-14-9-13(18-3)11(16)8-12(14)17/h8-10H,4-7,17H2,1-3H3 |
| InChIKey | DAIYOMTUHKEURD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|