C16H22FNO4 — CID 167110965
4-fluoro-5-[4-(hydroxymethyl)-4-methylcyclohexyl]oxy-2-methoxybenzamide (PubChem CID 167110965) has the molecular formula C16H22FNO4 and a molecular weight of 311.35 g/mol. Its IUPAC name is 4-fluoro-5-[4-(hydroxymethyl)-4-methylcyclohexyl]oxy-2-methoxybenzamide.
| Compound Name | 4-fluoro-5-[4-(hydroxymethyl)-4-methylcyclohexyl]oxy-2-methoxybenzamide |
|---|---|
| PubChem CID | 167110965 |
| Molecular Formula | C16H22FNO4 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 4-fluoro-5-[4-(hydroxymethyl)-4-methylcyclohexyl]oxy-2-methoxybenzamide |
| SMILES | COc1cc(F)c(OC2CCC(C)(CO)CC2)cc1C(N)=O |
| InChI | InChI=1S/C16H22FNO4/c1-16(9-19)5-3-10(4-6-16)22-14-7-11(15(18)20)13(21-2)8-12(14)17/h7-8,10,19H,3-6,9H2,1-2H3,(H2,18,20) |
| InChIKey | MDZUUMBVKAHYOF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |