C15H17FO6 — CID 170365424
4-fluoro-5-(4-formyl-4-hydroxycyclohexyl)oxy-2-methoxybenzoic acid (PubChem CID 170365424) has the molecular formula C15H17FO6 and a molecular weight of 312.29 g/mol. Its IUPAC name is 4-fluoro-5-(4-formyl-4-hydroxycyclohexyl)oxy-2-methoxybenzoic acid.
| Compound Name | 4-fluoro-5-(4-formyl-4-hydroxycyclohexyl)oxy-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 170365424 |
| Molecular Formula | C15H17FO6 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 4-fluoro-5-(4-formyl-4-hydroxycyclohexyl)oxy-2-methoxybenzoic acid |
| SMILES | COc1cc(F)c(OC2CCC(O)(C=O)CC2)cc1C(=O)O |
| InChI | InChI=1S/C15H17FO6/c1-21-12-7-11(16)13(6-10(12)14(18)19)22-9-2-4-15(20,8-17)5-3-9/h6-9,20H,2-5H2,1H3,(H,18,19) |
| InChIKey | VWAYINHJTPCIHO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|