C15H21FN4O4 — CID 163395366
5-[4-[(Z)-N-aminocarbamohydrazonoyl]cyclohexyl]oxy-4-fluoro-2-methoxybenzoic acid (PubChem CID 163395366) has the molecular formula C15H21FN4O4 and a molecular weight of 340.36 g/mol. Its IUPAC name is 5-[4-[(Z)-N-aminocarbamohydrazonoyl]cyclohexyl]oxy-4-fluoro-2-methoxybenzoic acid.
| Compound Name | 5-[4-[(Z)-N-aminocarbamohydrazonoyl]cyclohexyl]oxy-4-fluoro-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 163395366 |
| Molecular Formula | C15H21FN4O4 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 5-[4-[(Z)-N-aminocarbamohydrazonoyl]cyclohexyl]oxy-4-fluoro-2-methoxybenzoic acid |
| SMILES | COc1cc(F)c(OC2CCC(/C(=N/N)NN)CC2)cc1C(=O)O |
| InChI | InChI=1S/C15H21FN4O4/c1-23-12-7-11(16)13(6-10(12)15(21)22)24-9-4-2-8(3-5-9)14(19-17)20-18/h6-9H,2-5,17-18H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | IBDMHZARVFNKJK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|