C33H40ClN4O5+ — CID 11434055
[4-[[(2S)-1-[[(3S)-1-[(3-chlorophenyl)methyl]-1-methylpiperidin-1-ium-3-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoylamino]phenyl] 2-methylpropanoate (PubChem CID 11434055) has the molecular formula C33H40ClN4O5+ and a molecular weight of 608.16 g/mol. Its IUPAC name is [4-[[(2S)-1-[[(3S)-1-[(3-chlorophenyl)methyl]-1-methylpiperidin-1-ium-3-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoylamino]phenyl] 2-methylpropanoate.
| Compound Name | [4-[[(2S)-1-[[(3S)-1-[(3-chlorophenyl)methyl]-1-methylpiperidin-1-ium-3-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoylamino]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 11434055 |
| Molecular Formula | C33H40ClN4O5+ |
| Molecular Weight | 608.16 g/mol |
| Exact Mass | 607.27 |
| IUPAC Name | [4-[[(2S)-1-[[(3S)-1-[(3-chlorophenyl)methyl]-1-methylpiperidin-1-ium-3-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoylamino]phenyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1ccc(NC(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H]2CCC[N+](C)(Cc3cccc(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C33H39ClN4O5/c1-22(2)32(41)43-29-15-11-26(12-16-29)36-33(42)37-30(19-23-9-13-28(39)14-10-23)31(40)35-27-8-5-17-38(3,21-27)20-24-6-4-7-25(34)18-24/h4,6-7,9-16,18,22,27,30H,5,8,17,19-21H2,1-3H3,(H3-,35,36,37,39,40,42)/p+1/t27-,30-,38?/m0/s1 |
| InChIKey | JQIVCYXFNMHYTR-IIAQFCPMSA-O |
| XLogP | 5.27 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.16 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|