C30H38N5O6+ — CID 11331357
methyl 4-[[(2S)-3-(4-hydroxyphenyl)-1-[[(3S)-1-[(3-hydroxyphenyl)methyl]-1-methylpiperidin-1-ium-3-yl]amino]-1-oxopropan-2-yl]carbamoylamino]-1-methylpyrrole-2-carboxylate (PubChem CID 11331357) has the molecular formula C30H38N5O6+ and a molecular weight of 564.66 g/mol. Its IUPAC name is methyl 4-[[(2S)-3-(4-hydroxyphenyl)-1-[[(3S)-1-[(3-hydroxyphenyl)methyl]-1-methylpiperidin-1-ium-3-yl]amino]-1-oxopropan-2-yl]carbamoylamino]-1-methylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[[(2S)-3-(4-hydroxyphenyl)-1-[[(3S)-1-[(3-hydroxyphenyl)methyl]-1-methylpiperidin-1-ium-3-yl]amino]-1-oxopropan-2-yl]carbamoylamino]-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 11331357 |
| Molecular Formula | C30H38N5O6+ |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | methyl 4-[[(2S)-3-(4-hydroxyphenyl)-1-[[(3S)-1-[(3-hydroxyphenyl)methyl]-1-methylpiperidin-1-ium-3-yl]amino]-1-oxopropan-2-yl]carbamoylamino]-1-methylpyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H]2CCC[N+](C)(Cc3cccc(O)c3)C2)cn1C |
| InChI | InChI=1S/C30H37N5O6/c1-34-17-23(16-27(34)29(39)41-3)32-30(40)33-26(15-20-9-11-24(36)12-10-20)28(38)31-22-7-5-13-35(2,19-22)18-21-6-4-8-25(37)14-21/h4,6,8-12,14,16-17,22,26H,5,7,13,15,18-19H2,1-3H3,(H4-,31,32,33,36,37,38,40)/p+1/t22-,26-,35?/m0/s1 |
| InChIKey | OFPVVJZLTBTLHQ-ZSBBXIMESA-O |
| XLogP | 2.88 |
| TPSA | 141.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|