C38H41IN4O6 — CID 45266387
ethyl 4-[[(2S)-1-[[(3S)-1-(1,3-benzodioxol-5-ylmethyl)-1-methylpyrrolidin-1-ium-3-yl]amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]carbamoylamino]benzoate iodide (PubChem CID 45266387) has the molecular formula C38H41IN4O6 and a molecular weight of 776.67 g/mol. Its IUPAC name is ethyl 4-[[(2S)-1-[[(3S)-1-(1,3-benzodioxol-5-ylmethyl)-1-methylpyrrolidin-1-ium-3-yl]amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]carbamoylamino]benzoate iodide.
| Compound Name | ethyl 4-[[(2S)-1-[[(3S)-1-(1,3-benzodioxol-5-ylmethyl)-1-methylpyrrolidin-1-ium-3-yl]amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]carbamoylamino]benzoate iodide |
|---|---|
| PubChem CID | 45266387 |
| Molecular Formula | C38H41IN4O6 |
| Molecular Weight | 776.67 g/mol |
| Exact Mass | 776.21 |
| IUPAC Name | ethyl 4-[[(2S)-1-[[(3S)-1-(1,3-benzodioxol-5-ylmethyl)-1-methylpyrrolidin-1-ium-3-yl]amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]carbamoylamino]benzoate iodide |
| SMILES | CCOC(=O)c1ccc(NC(=O)N[C@@H](Cc2ccc(-c3ccccc3)cc2)C(=O)N[C@H]2CC[N+](C)(Cc3ccc4c(c3)OCO4)C2)cc1.[I-] |
| InChI | InChI=1S/C38H40N4O6.HI/c1-3-46-37(44)30-14-16-31(17-15-30)40-38(45)41-33(21-26-9-12-29(13-10-26)28-7-5-4-6-8-28)36(43)39-32-19-20-42(2,24-32)23-27-11-18-34-35(22-27)48-25-47-34;/h4-18,22,32-33H,3,19-21,23-25H2,1-2H3,(H2-,39,40,41,43,44,45);1H/t32-,33-,42?;/m0./s1 |
| InChIKey | TZMFISJHWGELJA-HUXLDHJRSA-N |
| XLogP | 2.53 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.67 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|