C17H27NO3 — CID 114340624
1-(4-aminophenoxy)-3-(4,4-dimethylcyclohexyl)oxypropan-2-ol (PubChem CID 114340624) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-(4-aminophenoxy)-3-(4,4-dimethylcyclohexyl)oxypropan-2-ol.
| Compound Name | 1-(4-aminophenoxy)-3-(4,4-dimethylcyclohexyl)oxypropan-2-ol |
|---|---|
| PubChem CID | 114340624 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 1-(4-aminophenoxy)-3-(4,4-dimethylcyclohexyl)oxypropan-2-ol |
| SMILES | CC1(C)CCC(OCC(O)COc2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C17H27NO3/c1-17(2)9-7-16(8-10-17)21-12-14(19)11-20-15-5-3-13(18)4-6-15/h3-6,14,16,19H,7-12,18H2,1-2H3 |
| InChIKey | GDVNSHWDXFQLHA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|