C17H25NO3 — CID 114341717
ethyl 3-amino-4-(4,4-dimethylcyclohexyl)oxybenzoate (PubChem CID 114341717) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is ethyl 3-amino-4-(4,4-dimethylcyclohexyl)oxybenzoate.
| Compound Name | ethyl 3-amino-4-(4,4-dimethylcyclohexyl)oxybenzoate |
|---|---|
| PubChem CID | 114341717 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | ethyl 3-amino-4-(4,4-dimethylcyclohexyl)oxybenzoate |
| SMILES | CCOC(=O)c1ccc(OC2CCC(C)(C)CC2)c(N)c1 |
| InChI | InChI=1S/C17H25NO3/c1-4-20-16(19)12-5-6-15(14(18)11-12)21-13-7-9-17(2,3)10-8-13/h5-6,11,13H,4,7-10,18H2,1-3H3 |
| InChIKey | YUERQICQRPVFOR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|