C16H24BrNO — CID 114342544
3-bromo-N-[2-(4,4-dimethylcyclohexyl)oxyethyl]aniline (PubChem CID 114342544) has the molecular formula C16H24BrNO and a molecular weight of 326.28 g/mol. Its IUPAC name is 3-bromo-N-[2-(4,4-dimethylcyclohexyl)oxyethyl]aniline.
| Compound Name | 3-bromo-N-[2-(4,4-dimethylcyclohexyl)oxyethyl]aniline |
|---|---|
| PubChem CID | 114342544 |
| Molecular Formula | C16H24BrNO |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 3-bromo-N-[2-(4,4-dimethylcyclohexyl)oxyethyl]aniline |
| SMILES | CC1(C)CCC(OCCNc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C16H24BrNO/c1-16(2)8-6-15(7-9-16)19-11-10-18-14-5-3-4-13(17)12-14/h3-5,12,15,18H,6-11H2,1-2H3 |
| InChIKey | ARJDMLGLUBDKTQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|