C12H12N4O5 — CID 114343389
1-[2-[(2,3-dihydroxybenzoyl)amino]ethyl]triazole-4-carboxylic acid (PubChem CID 114343389) has the molecular formula C12H12N4O5 and a molecular weight of 292.25 g/mol. Its IUPAC name is 1-[2-[(2,3-dihydroxybenzoyl)amino]ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[(2,3-dihydroxybenzoyl)amino]ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 114343389 |
| Molecular Formula | C12H12N4O5 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 1-[2-[(2,3-dihydroxybenzoyl)amino]ethyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(CCNC(=O)c2cccc(O)c2O)nn1 |
| InChI | InChI=1S/C12H12N4O5/c17-9-3-1-2-7(10(9)18)11(19)13-4-5-16-6-8(12(20)21)14-15-16/h1-3,6,17-18H,4-5H2,(H,13,19)(H,20,21) |
| InChIKey | XMXSUZNUFDZGLY-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|