C19H13N3O — CID 11434639
4-(furan-2-yl)-2,6-dipyridin-2-ylpyridine (PubChem CID 11434639) has the molecular formula C19H13N3O and a molecular weight of 299.33 g/mol. Its IUPAC name is 4-(furan-2-yl)-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-(furan-2-yl)-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 11434639 |
| Molecular Formula | C19H13N3O |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 4-(furan-2-yl)-2,6-dipyridin-2-ylpyridine |
| SMILES | c1ccc(-c2cc(-c3ccco3)cc(-c3ccccn3)n2)nc1 |
| InChI | InChI=1S/C19H13N3O/c1-3-9-20-15(6-1)17-12-14(19-8-5-11-23-19)13-18(22-17)16-7-2-4-10-21-16/h1-13H |
| InChIKey | VRHUPYNXILOLJW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |