C21H15N3O — CID 132918530
4-[(E)-2-(furan-2-yl)ethenyl]-2,6-dipyridin-2-ylpyridine (PubChem CID 132918530) has the molecular formula C21H15N3O and a molecular weight of 325.37 g/mol. Its IUPAC name is 4-[(E)-2-(furan-2-yl)ethenyl]-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-[(E)-2-(furan-2-yl)ethenyl]-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 132918530 |
| Molecular Formula | C21H15N3O |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 4-[(E)-2-(furan-2-yl)ethenyl]-2,6-dipyridin-2-ylpyridine |
| SMILES | C(=C/c1ccco1)\c1cc(-c2ccccn2)nc(-c2ccccn2)c1 |
| InChI | InChI=1S/C21H15N3O/c1-3-11-22-18(7-1)20-14-16(9-10-17-6-5-13-25-17)15-21(24-20)19-8-2-4-12-23-19/h1-15H/b10-9+ |
| InChIKey | DOXRZBKRJVCTEK-MDZDMXLPSA-N |
| XLogP | 4.97 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |