C15H13FN2O2S — CID 114348621
2-[(4-fluoro-2-methylphenyl)methylsulfinyl]-1,3-benzoxazol-5-amine (PubChem CID 114348621) has the molecular formula C15H13FN2O2S and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[(4-fluoro-2-methylphenyl)methylsulfinyl]-1,3-benzoxazol-5-amine.
| Compound Name | 2-[(4-fluoro-2-methylphenyl)methylsulfinyl]-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 114348621 |
| Molecular Formula | C15H13FN2O2S |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 2-[(4-fluoro-2-methylphenyl)methylsulfinyl]-1,3-benzoxazol-5-amine |
| SMILES | Cc1cc(F)ccc1CS(=O)c1nc2cc(N)ccc2o1 |
| InChI | InChI=1S/C15H13FN2O2S/c1-9-6-11(16)3-2-10(9)8-21(19)15-18-13-7-12(17)4-5-14(13)20-15/h2-7H,8,17H2,1H3 |
| InChIKey | LKQIJVCFULCVLI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|