C14H10ClFN2O2S — CID 61496646
2-[(2-chloro-6-fluorophenyl)methylsulfinyl]-1,3-benzoxazol-5-amine (PubChem CID 61496646) has the molecular formula C14H10ClFN2O2S and a molecular weight of 324.76 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methylsulfinyl]-1,3-benzoxazol-5-amine.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methylsulfinyl]-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 61496646 |
| Molecular Formula | C14H10ClFN2O2S |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methylsulfinyl]-1,3-benzoxazol-5-amine |
| SMILES | Nc1ccc2oc(S(=O)Cc3c(F)cccc3Cl)nc2c1 |
| InChI | InChI=1S/C14H10ClFN2O2S/c15-10-2-1-3-11(16)9(10)7-21(19)14-18-12-6-8(17)4-5-13(12)20-14/h1-6H,7,17H2 |
| InChIKey | OFSXCEOWWYTMEM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|